About 2-bromoethyl 3-chlorobenzoate
2-bromoethyl 3-chlorobenzoate (PubChem CID 21411127) has the molecular formula C9H8BrClO2
and a molecular weight of 263.52 g/mol. Its IUPAC name is 2-bromoethyl 3-chlorobenzoate.
Molecular Properties
| Compound Name | 2-bromoethyl 3-chlorobenzoate |
| PubChem CID | 21411127 |
| Molecular Formula | C9H8BrClO2 |
| Molecular Weight | 263.52 g/mol |
| Exact Mass | 261.94 |
| IUPAC Name | 2-bromoethyl 3-chlorobenzoate |
| SMILES | O=C(OCCBr)c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H8BrClO2/c10-4-5-13-9(12)7-2-1-3-8(11)6-7/h1-3,6H,4-5H2 |
| InChIKey | JDQZZJVVJMUZRP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethyl 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethyl 3-chlorobenzoate?
The IUPAC name of 2-bromoethyl 3-chlorobenzoate (CID 21411127) is 2-bromoethyl 3-chlorobenzoate.
What is the SMILES notation for 2-bromoethyl 3-chlorobenzoate?
The canonical SMILES for 2-bromoethyl 3-chlorobenzoate is O=C(OCCBr)c1cccc(Cl)c1.
What is the InChIKey of 2-bromoethyl 3-chlorobenzoate?
The InChIKey is JDQZZJVVJMUZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrClO2/c10-4-5-13-9(12)7-2-1-3-8(11)6-7/h1-3,6H,4-5H2.
What are the key properties of 2-bromoethyl 3-chlorobenzoate?
2-bromoethyl 3-chlorobenzoate has a molecular weight of 263.52 g/mol, XLogP of 2.89, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl 3-chlorobenzoate is sourced from PubChem (CID 21411127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).