About 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate
3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate (PubChem CID 23125966) has the molecular formula C19H18Cl2O4
and a molecular weight of 381.25 g/mol. Its IUPAC name is 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate.
Molecular Properties
| Compound Name | 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate |
| PubChem CID | 23125966 |
| Molecular Formula | C19H18Cl2O4 |
| Molecular Weight | 381.25 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate |
| SMILES | CCC(CCOC(=O)c1cccc(Cl)c1)OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2O4/c1-2-17(25-19(23)14-6-4-8-16(21)12-14)9-10-24-18(22)13-5-3-7-15(20)11-13/h3-8,11-12,17H,2,9-10H2,1H3 |
| InChIKey | IWMPLCFVPZFTKN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate?
The IUPAC name of 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate (CID 23125966) is 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate.
What is the SMILES notation for 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate?
The canonical SMILES for 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate is CCC(CCOC(=O)c1cccc(Cl)c1)OC(=O)c1cccc(Cl)c1.
What is the InChIKey of 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate?
The InChIKey is IWMPLCFVPZFTKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18Cl2O4/c1-2-17(25-19(23)14-6-4-8-16(21)12-14)9-10-24-18(22)13-5-3-7-15(20)11-13/h3-8,11-12,17H,2,9-10H2,1H3.
What are the key properties of 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate?
3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate has a molecular weight of 381.25 g/mol, XLogP of 5.18, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorobenzoyl)oxypentyl 3-chlorobenzoate is sourced from PubChem (CID 23125966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).