About 2-(2-methylpropoxy)ethyl 3-chlorobenzoate
2-(2-methylpropoxy)ethyl 3-chlorobenzoate (PubChem CID 71145273) has the molecular formula C13H17ClO3
and a molecular weight of 256.73 g/mol. Its IUPAC name is 2-(2-methylpropoxy)ethyl 3-chlorobenzoate.
Molecular Properties
| Compound Name | 2-(2-methylpropoxy)ethyl 3-chlorobenzoate |
| PubChem CID | 71145273 |
| Molecular Formula | C13H17ClO3 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 2-(2-methylpropoxy)ethyl 3-chlorobenzoate |
| SMILES | CC(C)COCCOC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H17ClO3/c1-10(2)9-16-6-7-17-13(15)11-4-3-5-12(14)8-11/h3-5,8,10H,6-7,9H2,1-2H3 |
| InChIKey | WQRKHZLJGWCXNK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylpropoxy)ethyl 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropoxy)ethyl 3-chlorobenzoate?
The IUPAC name of 2-(2-methylpropoxy)ethyl 3-chlorobenzoate (CID 71145273) is 2-(2-methylpropoxy)ethyl 3-chlorobenzoate.
What is the SMILES notation for 2-(2-methylpropoxy)ethyl 3-chlorobenzoate?
The canonical SMILES for 2-(2-methylpropoxy)ethyl 3-chlorobenzoate is CC(C)COCCOC(=O)c1cccc(Cl)c1.
What is the InChIKey of 2-(2-methylpropoxy)ethyl 3-chlorobenzoate?
The InChIKey is WQRKHZLJGWCXNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO3/c1-10(2)9-16-6-7-17-13(15)11-4-3-5-12(14)8-11/h3-5,8,10H,6-7,9H2,1-2H3.
What are the key properties of 2-(2-methylpropoxy)ethyl 3-chlorobenzoate?
2-(2-methylpropoxy)ethyl 3-chlorobenzoate has a molecular weight of 256.73 g/mol, XLogP of 3.17, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropoxy)ethyl 3-chlorobenzoate is sourced from PubChem (CID 71145273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).