About 2-bromoethyl 3-(fluoromethyl)benzoate
2-bromoethyl 3-(fluoromethyl)benzoate (PubChem CID 174485566) has the molecular formula C10H10BrFO2
and a molecular weight of 261.09 g/mol. Its IUPAC name is 2-bromoethyl 3-(fluoromethyl)benzoate.
Molecular Properties
| Compound Name | 2-bromoethyl 3-(fluoromethyl)benzoate |
| PubChem CID | 174485566 |
| Molecular Formula | C10H10BrFO2 |
| Molecular Weight | 261.09 g/mol |
| Exact Mass | 259.98 |
| IUPAC Name | 2-bromoethyl 3-(fluoromethyl)benzoate |
| SMILES | O=C(OCCBr)c1cccc(CF)c1 |
| InChI | InChI=1S/C10H10BrFO2/c11-4-5-14-10(13)9-3-1-2-8(6-9)7-12/h1-3,6H,4-5,7H2 |
| InChIKey | ROBPNGJINMHWAC-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.09 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethyl 3-(fluoromethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethyl 3-(fluoromethyl)benzoate?
The IUPAC name of 2-bromoethyl 3-(fluoromethyl)benzoate (CID 174485566) is 2-bromoethyl 3-(fluoromethyl)benzoate.
What is the SMILES notation for 2-bromoethyl 3-(fluoromethyl)benzoate?
The canonical SMILES for 2-bromoethyl 3-(fluoromethyl)benzoate is O=C(OCCBr)c1cccc(CF)c1.
What is the InChIKey of 2-bromoethyl 3-(fluoromethyl)benzoate?
The InChIKey is ROBPNGJINMHWAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrFO2/c11-4-5-14-10(13)9-3-1-2-8(6-9)7-12/h1-3,6H,4-5,7H2.
What are the key properties of 2-bromoethyl 3-(fluoromethyl)benzoate?
2-bromoethyl 3-(fluoromethyl)benzoate has a molecular weight of 261.09 g/mol, XLogP of 2.71, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethyl 3-(fluoromethyl)benzoate is sourced from PubChem (CID 174485566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).