About [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate
[[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate (PubChem CID 5228997) has the molecular formula C20H12Cl2N2O4
and a molecular weight of 415.23 g/mol. Its IUPAC name is [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate.
Molecular Properties
| Compound Name | [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate |
| PubChem CID | 5228997 |
| Molecular Formula | C20H12Cl2N2O4 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate |
| SMILES | O=C(ON=C1C=CC(=NOC(=O)c2cccc(Cl)c2)C=C1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H12Cl2N2O4/c21-15-5-1-3-13(11-15)19(25)27-23-17-7-9-18(10-8-17)24-28-20(26)14-4-2-6-16(22)12-14/h1-12H/b23-17-,24-18+ |
| InChIKey | POJYHDBVPQSYNG-QFFDILLMSA-N |
| XLogP | 4.85 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate?
The IUPAC name of [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate (CID 5228997) is [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate.
What is the SMILES notation for [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate?
The canonical SMILES for [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate is O=C(ON=C1C=CC(=NOC(=O)c2cccc(Cl)c2)C=C1)c1cccc(Cl)c1.
What is the InChIKey of [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate?
The InChIKey is POJYHDBVPQSYNG-QFFDILLMSA-N. The full InChI is InChI=1S/C20H12Cl2N2O4/c21-15-5-1-3-13(11-15)19(25)27-23-17-7-9-18(10-8-17)24-28-20(26)14-4-2-6-16(22)12-14/h1-12H/b23-17-,24-18+.
What are the key properties of [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate?
[[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate has a molecular weight of 415.23 g/mol, XLogP of 4.85, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[4-(3-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 3-chlorobenzoate is sourced from PubChem (CID 5228997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).