C20H12Cl2N2O4 — CID 5120586
[[4-(4-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 2-chlorobenzoate (PubChem CID 5120586) has the molecular formula C20H12Cl2N2O4 and a molecular weight of 415.23 g/mol. Its IUPAC name is [[4-(4-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 2-chlorobenzoate.
| Compound Name | [[4-(4-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 2-chlorobenzoate |
|---|---|
| PubChem CID | 5120586 |
| Molecular Formula | C20H12Cl2N2O4 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 414.02 |
| IUPAC Name | [[4-(4-chlorobenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 2-chlorobenzoate |
| SMILES | O=C(ON=C1C=CC(=NOC(=O)c2ccccc2Cl)C=C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H12Cl2N2O4/c21-14-7-5-13(6-8-14)19(25)27-23-15-9-11-16(12-10-15)24-28-20(26)17-3-1-2-4-18(17)22/h1-12H/b23-15-,24-16+ |
| InChIKey | JJFRROVFSOSTAM-REPVBDINSA-N |
| XLogP | 4.85 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|