C13H8ClNO3 — CID 885328
[(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 2-chlorobenzoate (PubChem CID 885328) has the molecular formula C13H8ClNO3 and a molecular weight of 261.66 g/mol. Its IUPAC name is [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 2-chlorobenzoate.
| Compound Name | [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 2-chlorobenzoate |
|---|---|
| PubChem CID | 885328 |
| Molecular Formula | C13H8ClNO3 |
| Molecular Weight | 261.66 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | [(4-oxocyclohexa-2,5-dien-1-ylidene)amino] 2-chlorobenzoate |
| SMILES | O=C1C=CC(=NOC(=O)c2ccccc2Cl)C=C1 |
| InChI | InChI=1S/C13H8ClNO3/c14-12-4-2-1-3-11(12)13(17)18-15-9-5-7-10(16)8-6-9/h1-8H |
| InChIKey | VTIFQUUALUCMLZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|