C21H15BrN2O4 — CID 5120579
[[4-(4-methylbenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 2-bromobenzoate (PubChem CID 5120579) has the molecular formula C21H15BrN2O4 and a molecular weight of 439.27 g/mol. Its IUPAC name is [[4-(4-methylbenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 2-bromobenzoate.
| Compound Name | [[4-(4-methylbenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 2-bromobenzoate |
|---|---|
| PubChem CID | 5120579 |
| Molecular Formula | C21H15BrN2O4 |
| Molecular Weight | 439.27 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | [[4-(4-methylbenzoyl)oxyiminocyclohexa-2,5-dien-1-ylidene]amino] 2-bromobenzoate |
| SMILES | Cc1ccc(C(=O)ON=C2C=CC(=NOC(=O)c3ccccc3Br)C=C2)cc1 |
| InChI | InChI=1S/C21H15BrN2O4/c1-14-6-8-15(9-7-14)20(25)27-23-16-10-12-17(13-11-16)24-28-21(26)18-4-2-3-5-19(18)22/h2-13H,1H3/b23-16-,24-17+ |
| InChIKey | HSHRHZCRGZYMAV-JVBWRSBESA-N |
| XLogP | 4.61 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.27 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|