C15H10BrCl2NO2 — CID 6084821
[(Z)-1-(3,4-dichlorophenyl)ethylideneamino] 2-bromobenzoate (PubChem CID 6084821) has the molecular formula C15H10BrCl2NO2 and a molecular weight of 387.06 g/mol. Its IUPAC name is [(Z)-1-(3,4-dichlorophenyl)ethylideneamino] 2-bromobenzoate.
| Compound Name | [(Z)-1-(3,4-dichlorophenyl)ethylideneamino] 2-bromobenzoate |
|---|---|
| PubChem CID | 6084821 |
| Molecular Formula | C15H10BrCl2NO2 |
| Molecular Weight | 387.06 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | [(Z)-1-(3,4-dichlorophenyl)ethylideneamino] 2-bromobenzoate |
| SMILES | C/C(=N/OC(=O)c1ccccc1Br)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10BrCl2NO2/c1-9(10-6-7-13(17)14(18)8-10)19-21-15(20)11-4-2-3-5-12(11)16/h2-8H,1H3/b19-9- |
| InChIKey | ZSHVBVNJRWBZEV-OCKHKDLRSA-N |
| XLogP | 5.34 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.06 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|