C16H12Cl4N2 — CID 2827019
1-(3,4-dichlorophenyl)-N-[1-(3,4-dichlorophenyl)ethylideneamino]ethanimine (PubChem CID 2827019) has the molecular formula C16H12Cl4N2 and a molecular weight of 374.10 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-N-[1-(3,4-dichlorophenyl)ethylideneamino]ethanimine.
| Compound Name | 1-(3,4-dichlorophenyl)-N-[1-(3,4-dichlorophenyl)ethylideneamino]ethanimine |
|---|---|
| PubChem CID | 2827019 |
| Molecular Formula | C16H12Cl4N2 |
| Molecular Weight | 374.10 g/mol |
| Exact Mass | 371.98 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-N-[1-(3,4-dichlorophenyl)ethylideneamino]ethanimine |
| SMILES | CC(=NN=C(C)c1ccc(Cl)c(Cl)c1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl4N2/c1-9(11-3-5-13(17)15(19)7-11)21-22-10(2)12-4-6-14(18)16(20)8-12/h3-8H,1-2H3 |
| InChIKey | UUHPCZQERPHDJK-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.10 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|