C9H7BrCl2 — CID 87184625
4-[(E)-1-bromoprop-1-en-2-yl]-1,2-dichlorobenzene (PubChem CID 87184625) has the molecular formula C9H7BrCl2 and a molecular weight of 265.96 g/mol. Its IUPAC name is 4-[(E)-1-bromoprop-1-en-2-yl]-1,2-dichlorobenzene.
| Compound Name | 4-[(E)-1-bromoprop-1-en-2-yl]-1,2-dichlorobenzene |
|---|---|
| PubChem CID | 87184625 |
| Molecular Formula | C9H7BrCl2 |
| Molecular Weight | 265.96 g/mol |
| Exact Mass | 263.91 |
| IUPAC Name | 4-[(E)-1-bromoprop-1-en-2-yl]-1,2-dichlorobenzene |
| SMILES | C/C(=C\Br)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H7BrCl2/c1-6(5-10)7-2-3-8(11)9(12)4-7/h2-5H,1H3/b6-5+ |
| InChIKey | KXSBFMZEXKZGJC-AATRIKPKSA-N |
| XLogP | 4.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.96 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |