C16H16Cl2NO2S- — CID 175087615
1,2-dichloro-4-[1-(sulfinatoamino)prop-1-en-2-yl]benzene;toluene (PubChem CID 175087615) has the molecular formula C16H16Cl2NO2S- and a molecular weight of 357.28 g/mol. Its IUPAC name is 1,2-dichloro-4-[1-(sulfinatoamino)prop-1-en-2-yl]benzene;toluene.
| Compound Name | 1,2-dichloro-4-[1-(sulfinatoamino)prop-1-en-2-yl]benzene;toluene |
|---|---|
| PubChem CID | 175087615 |
| Molecular Formula | C16H16Cl2NO2S- |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 1,2-dichloro-4-[1-(sulfinatoamino)prop-1-en-2-yl]benzene;toluene |
| SMILES | CC(=CNS(=O)[O-])c1ccc(Cl)c(Cl)c1.Cc1ccccc1 |
| InChI | InChI=1S/C9H9Cl2NO2S.C7H8/c1-6(5-12-15(13)14)7-2-3-8(10)9(11)4-7;1-7-5-3-2-4-6-7/h2-5,12H,1H3,(H,13,14);2-6H,1H3/p-1 |
| InChIKey | OAULOOHTIVOAIL-UHFFFAOYSA-M |
| XLogP | 4.73 |
| TPSA | 52.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|