C9H9Cl2NOS — CID 164646072
(NZ)-N-[1-(3,4-dichlorophenyl)ethylidene]methanesulfinamide (PubChem CID 164646072) has the molecular formula C9H9Cl2NOS and a molecular weight of 250.15 g/mol. Its IUPAC name is (NZ)-N-[1-(3,4-dichlorophenyl)ethylidene]methanesulfinamide.
| Compound Name | (NZ)-N-[1-(3,4-dichlorophenyl)ethylidene]methanesulfinamide |
|---|---|
| PubChem CID | 164646072 |
| Molecular Formula | C9H9Cl2NOS |
| Molecular Weight | 250.15 g/mol |
| Exact Mass | 248.98 |
| IUPAC Name | (NZ)-N-[1-(3,4-dichlorophenyl)ethylidene]methanesulfinamide |
| SMILES | C/C(=N/S(C)=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C9H9Cl2NOS/c1-6(12-14(2)13)7-3-4-8(10)9(11)5-7/h3-5H,1-2H3/b12-6- |
| InChIKey | FGTMRLIDSGYZHH-SDQBBNPISA-N |
| XLogP | 3.10 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.15 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|