C15H13Cl2NO3S — CID 70123676
1-(3,4-dichlorophenyl)-2-pyridin-4-ylethane-1,2-dione;methylsulfinylmethane (PubChem CID 70123676) has the molecular formula C15H13Cl2NO3S and a molecular weight of 358.25 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-2-pyridin-4-ylethane-1,2-dione;methylsulfinylmethane.
| Compound Name | 1-(3,4-dichlorophenyl)-2-pyridin-4-ylethane-1,2-dione;methylsulfinylmethane |
|---|---|
| PubChem CID | 70123676 |
| Molecular Formula | C15H13Cl2NO3S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-2-pyridin-4-ylethane-1,2-dione;methylsulfinylmethane |
| SMILES | CS(C)=O.O=C(C(=O)c1ccc(Cl)c(Cl)c1)c1ccncc1 |
| InChI | InChI=1S/C13H7Cl2NO2.C2H6OS/c14-10-2-1-9(7-11(10)15)13(18)12(17)8-3-5-16-6-4-8;1-4(2)3/h1-7H;1-2H3 |
| InChIKey | CENRGSLCCDRYPK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 64.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|