C14H9Cl5N2 — CID 3972659
2,4,6-trichloro-N-[1-(3,4-dichlorophenyl)ethylideneamino]aniline (PubChem CID 3972659) has the molecular formula C14H9Cl5N2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 2,4,6-trichloro-N-[1-(3,4-dichlorophenyl)ethylideneamino]aniline.
| Compound Name | 2,4,6-trichloro-N-[1-(3,4-dichlorophenyl)ethylideneamino]aniline |
|---|---|
| PubChem CID | 3972659 |
| Molecular Formula | C14H9Cl5N2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | 2,4,6-trichloro-N-[1-(3,4-dichlorophenyl)ethylideneamino]aniline |
| SMILES | CC(=NNc1c(Cl)cc(Cl)cc1Cl)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H9Cl5N2/c1-7(8-2-3-10(16)11(17)4-8)20-21-14-12(18)5-9(15)6-13(14)19/h2-6,21H,1H3 |
| InChIKey | OVFUMGCOMRELDV-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|