C14H11Cl3N2O — CID 137300721
2-[(Z)-C-methyl-N-(2,4,6-trichloroanilino)carbonimidoyl]phenol (PubChem CID 137300721) has the molecular formula C14H11Cl3N2O and a molecular weight of 329.61 g/mol. Its IUPAC name is 2-[(Z)-C-methyl-N-(2,4,6-trichloroanilino)carbonimidoyl]phenol.
| Compound Name | 2-[(Z)-C-methyl-N-(2,4,6-trichloroanilino)carbonimidoyl]phenol |
|---|---|
| PubChem CID | 137300721 |
| Molecular Formula | C14H11Cl3N2O |
| Molecular Weight | 329.61 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | 2-[(Z)-C-methyl-N-(2,4,6-trichloroanilino)carbonimidoyl]phenol |
| SMILES | C/C(=N/Nc1c(Cl)cc(Cl)cc1Cl)c1ccccc1O |
| InChI | InChI=1S/C14H11Cl3N2O/c1-8(10-4-2-3-5-13(10)20)18-19-14-11(16)6-9(15)7-12(14)17/h2-7,19-20H,1H3/b18-8- |
| InChIKey | KOGRDDVBRZAHKK-LSCVHKIXSA-N |
| XLogP | 5.19 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.61 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|