C15H7Cl4N3O — CID 73122114
2-(2-chlorophenyl)-2-oxo-N-(2,4,6-trichloroanilino)ethanimidoyl cyanide (PubChem CID 73122114) has the molecular formula C15H7Cl4N3O and a molecular weight of 387.05 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-oxo-N-(2,4,6-trichloroanilino)ethanimidoyl cyanide.
| Compound Name | 2-(2-chlorophenyl)-2-oxo-N-(2,4,6-trichloroanilino)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 73122114 |
| Molecular Formula | C15H7Cl4N3O |
| Molecular Weight | 387.05 g/mol |
| Exact Mass | 384.93 |
| IUPAC Name | 2-(2-chlorophenyl)-2-oxo-N-(2,4,6-trichloroanilino)ethanimidoyl cyanide |
| SMILES | N#CC(=NNc1c(Cl)cc(Cl)cc1Cl)C(=O)c1ccccc1Cl |
| InChI | InChI=1S/C15H7Cl4N3O/c16-8-5-11(18)14(12(19)6-8)22-21-13(7-20)15(23)9-3-1-2-4-10(9)17/h1-6,22H |
| InChIKey | BRRWQCIRUSQQKZ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.05 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|