C20H16ClN5O2 — CID 5441374
(1E)-2-(4-chlorophenyl)-N-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethanimidoyl cyanide (PubChem CID 5441374) has the molecular formula C20H16ClN5O2 and a molecular weight of 393.83 g/mol. Its IUPAC name is (1E)-2-(4-chlorophenyl)-N-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethanimidoyl cyanide.
| Compound Name | (1E)-2-(4-chlorophenyl)-N-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethanimidoyl cyanide |
|---|---|
| PubChem CID | 5441374 |
| Molecular Formula | C20H16ClN5O2 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (1E)-2-(4-chlorophenyl)-N-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxoethanimidoyl cyanide |
| SMILES | Cc1c(N/N=C(\C#N)C(=O)c2ccc(Cl)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H16ClN5O2/c1-13-18(20(28)26(25(13)2)16-6-4-3-5-7-16)24-23-17(12-22)19(27)14-8-10-15(21)11-9-14/h3-11,24H,1-2H3/b23-17+ |
| InChIKey | UFDYZAPZXVKHSJ-HAVVHWLPSA-N |
| XLogP | 3.31 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|