C26H21N5O2 — CID 1104597
N-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxo-2-(4-phenylphenyl)ethanimidoyl cyanide (PubChem CID 1104597) has the molecular formula C26H21N5O2 and a molecular weight of 435.49 g/mol. Its IUPAC name is N-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxo-2-(4-phenylphenyl)ethanimidoyl cyanide.
| Compound Name | N-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxo-2-(4-phenylphenyl)ethanimidoyl cyanide |
|---|---|
| PubChem CID | 1104597 |
| Molecular Formula | C26H21N5O2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-2-oxo-2-(4-phenylphenyl)ethanimidoyl cyanide |
| SMILES | Cc1c(NN=C(C#N)C(=O)c2ccc(-c3ccccc3)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C26H21N5O2/c1-18-24(26(33)31(30(18)2)22-11-7-4-8-12-22)29-28-23(17-27)25(32)21-15-13-20(14-16-21)19-9-5-3-6-10-19/h3-16,29H,1-2H3 |
| InChIKey | CEUQERDGJFZWGT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|