C21H25N7OS2 — CID 70677178
methyl (NE)-N-[(2Z)-2-cyano-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)hydrazinylidene]-1-piperidin-1-ylethylidene]carbamodithioate (PubChem CID 70677178) has the molecular formula C21H25N7OS2 and a molecular weight of 455.61 g/mol. Its IUPAC name is methyl (NE)-N-[(2Z)-2-cyano-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)hydrazinylidene]-1-piperidin-1-ylethylidene]carbamodithioate.
| Compound Name | methyl (NE)-N-[(2Z)-2-cyano-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)hydrazinylidene]-1-piperidin-1-ylethylidene]carbamodithioate |
|---|---|
| PubChem CID | 70677178 |
| Molecular Formula | C21H25N7OS2 |
| Molecular Weight | 455.61 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | methyl (NE)-N-[(2Z)-2-cyano-2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)hydrazinylidene]-1-piperidin-1-ylethylidene]carbamodithioate |
| SMILES | CSC(=S)/N=C(C(\C#N)=N/Nc1c(C)n(C)n(-c2ccccc2)c1=O)/N1CCCCC1 |
| InChI | InChI=1S/C21H25N7OS2/c1-15-18(20(29)28(26(15)2)16-10-6-4-7-11-16)25-24-17(14-22)19(23-21(30)31-3)27-12-8-5-9-13-27/h4,6-7,10-11,25H,5,8-9,12-13H2,1-3H3/b23-19+,24-17- |
| InChIKey | FSNHJSZVSDQUTI-SOSXSPFWSA-N |
| XLogP | 3.31 |
| TPSA | 90.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.61 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_imine_A(37)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|