C12H15MgN3O — CID 175754430
CID 175754430 (PubChem CID 175754430) has the molecular formula C12H15MgN3O and a molecular weight of 241.58 g/mol.
| Compound Name | CID 175754430 |
|---|---|
| PubChem CID | 175754430 |
| Molecular Formula | C12H15MgN3O |
| Molecular Weight | 241.58 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | — |
| SMILES | CNc1c(C)n(C)n(-c2ccccc2)c1=O.[Mg] |
| InChI | InChI=1S/C12H15N3O.Mg/c1-9-11(13-2)12(16)15(14(9)3)10-7-5-4-6-8-10;/h4-8,13H,1-3H3; |
| InChIKey | HKVMGMRARZEGEK-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.58 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |