C46H46N8O4 — CID 3366535
1,5-dimethyl-2-phenyl-4-[1,2,2-tris(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)ethyl]pyrazol-3-one (PubChem CID 3366535) has the molecular formula C46H46N8O4 and a molecular weight of 774.93 g/mol. Its IUPAC name is 1,5-dimethyl-2-phenyl-4-[1,2,2-tris(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)ethyl]pyrazol-3-one.
| Compound Name | 1,5-dimethyl-2-phenyl-4-[1,2,2-tris(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)ethyl]pyrazol-3-one |
|---|---|
| PubChem CID | 3366535 |
| Molecular Formula | C46H46N8O4 |
| Molecular Weight | 774.93 g/mol |
| Exact Mass | 774.36 |
| IUPAC Name | 1,5-dimethyl-2-phenyl-4-[1,2,2-tris(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)ethyl]pyrazol-3-one |
| SMILES | Cc1c(C(c2c(C)n(C)n(-c3ccccc3)c2=O)C(c2c(C)n(C)n(-c3ccccc3)c2=O)c2c(C)n(C)n(-c3ccccc3)c2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C46H46N8O4/c1-29-37(43(55)51(47(29)5)33-21-13-9-14-22-33)41(38-30(2)48(6)52(44(38)56)34-23-15-10-16-24-34)42(39-31(3)49(7)53(45(39)57)35-25-17-11-18-26-35)40-32(4)50(8)54(46(40)58)36-27-19-12-20-28-36/h9-28,41-42H,1-8H3 |
| InChIKey | QFQCUEWAUPBXRY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 107.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.93 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |