C31H29N5O4 — CID 46778999
4-[(E)-1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2-nitrophenyl)prop-2-enyl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 46778999) has the molecular formula C31H29N5O4 and a molecular weight of 535.60 g/mol. Its IUPAC name is 4-[(E)-1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2-nitrophenyl)prop-2-enyl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(E)-1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2-nitrophenyl)prop-2-enyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 46778999 |
| Molecular Formula | C31H29N5O4 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | 4-[(E)-1-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-(2-nitrophenyl)prop-2-enyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(C(/C=C/c2ccccc2[N+](=O)[O-])c2c(C)n(C)n(-c3ccccc3)c2=O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C31H29N5O4/c1-21-28(30(37)34(32(21)3)24-14-7-5-8-15-24)26(20-19-23-13-11-12-18-27(23)36(39)40)29-22(2)33(4)35(31(29)38)25-16-9-6-10-17-25/h5-20,26H,1-4H3/b20-19+ |
| InChIKey | TVWJFKYRSPXZJB-FMQUCBEESA-N |
| XLogP | 5.04 |
| TPSA | 97.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|