C21H21N5O5 — CID 112759168
N-[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl]-3-nitrobenzamide (PubChem CID 112759168) has the molecular formula C21H21N5O5 and a molecular weight of 423.43 g/mol. Its IUPAC name is N-[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 112759168 |
| Molecular Formula | C21H21N5O5 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | N-[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl]-3-nitrobenzamide |
| SMILES | Cc1c(NC(=O)C(C)NC(=O)c2cccc([N+](=O)[O-])c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C21H21N5O5/c1-13(22-20(28)15-8-7-11-17(12-15)26(30)31)19(27)23-18-14(2)24(3)25(21(18)29)16-9-5-4-6-10-16/h4-13H,1-3H3,(H,22,28)(H,23,27) |
| InChIKey | HTJUEQCRUSKGJO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|