C27H23N5O5 — CID 74638618
N-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 74638618) has the molecular formula C27H23N5O5 and a molecular weight of 497.51 g/mol. Its IUPAC name is N-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | N-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 74638618 |
| Molecular Formula | C27H23N5O5 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | N-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-(3-nitrophenyl)-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | Cc1c(NC(=O)C(=Cc2cccc([N+](=O)[O-])c2)NC(=O)c2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H23N5O5/c1-18-24(27(35)31(30(18)2)21-13-7-4-8-14-21)29-26(34)23(28-25(33)20-11-5-3-6-12-20)17-19-10-9-15-22(16-19)32(36)37/h3-17H,1-2H3,(H,28,33)(H,29,34) |
| InChIKey | QLBOYJHWOXFDQQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|