C27H22Cl2N4O3 — CID 74638609
2,4-dichloro-N-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide (PubChem CID 74638609) has the molecular formula C27H22Cl2N4O3 and a molecular weight of 521.40 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 74638609 |
| Molecular Formula | C27H22Cl2N4O3 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 520.11 |
| IUPAC Name | 2,4-dichloro-N-[3-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-3-oxo-1-phenylprop-1-en-2-yl]benzamide |
| SMILES | Cc1c(NC(=O)C(=Cc2ccccc2)NC(=O)c2ccc(Cl)cc2Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C27H22Cl2N4O3/c1-17-24(27(36)33(32(17)2)20-11-7-4-8-12-20)31-26(35)23(15-18-9-5-3-6-10-18)30-25(34)21-14-13-19(28)16-22(21)29/h3-16H,1-2H3,(H,30,34)(H,31,35) |
| InChIKey | GTZUYCDTISCJTN-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|