C22H27N5O6S — CID 52909476
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-[[(2S)-3-hydroxy-3-methylbutan-2-yl]amino]-3-nitrobenzenesulfonamide (PubChem CID 52909476) has the molecular formula C22H27N5O6S and a molecular weight of 489.55 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-[[(2S)-3-hydroxy-3-methylbutan-2-yl]amino]-3-nitrobenzenesulfonamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-[[(2S)-3-hydroxy-3-methylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 52909476 |
| Molecular Formula | C22H27N5O6S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-4-[[(2S)-3-hydroxy-3-methylbutan-2-yl]amino]-3-nitrobenzenesulfonamide |
| SMILES | Cc1c(NS(=O)(=O)c2ccc(N[C@@H](C)C(C)(C)O)c([N+](=O)[O-])c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H27N5O6S/c1-14-20(21(28)26(25(14)5)16-9-7-6-8-10-16)24-34(32,33)17-11-12-18(19(13-17)27(30)31)23-15(2)22(3,4)29/h6-13,15,23-24,29H,1-5H3/t15-/m0/s1 |
| InChIKey | UNQKESRBPMOUPI-HNNXBMFYSA-N |
| XLogP | 2.76 |
| TPSA | 148.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|