C22H21N5O5S2 — CID 55346745
N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-nitro-4-(thiophen-2-ylmethylamino)benzenesulfonamide (PubChem CID 55346745) has the molecular formula C22H21N5O5S2 and a molecular weight of 499.57 g/mol. Its IUPAC name is N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-nitro-4-(thiophen-2-ylmethylamino)benzenesulfonamide.
| Compound Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-nitro-4-(thiophen-2-ylmethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 55346745 |
| Molecular Formula | C22H21N5O5S2 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | N-(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)-3-nitro-4-(thiophen-2-ylmethylamino)benzenesulfonamide |
| SMILES | Cc1c(NS(=O)(=O)c2ccc(NCc3cccs3)c([N+](=O)[O-])c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C22H21N5O5S2/c1-15-21(22(28)26(25(15)2)16-7-4-3-5-8-16)24-34(31,32)18-10-11-19(20(13-18)27(29)30)23-14-17-9-6-12-33-17/h3-13,23-24H,14H2,1-2H3 |
| InChIKey | RVYOCAVHYDXXRC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 128.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|