C13H13Cl3N2O2 — CID 4227069
1,5-dimethyl-2-phenyl-4-(2,2,2-trichloro-1-hydroxyethyl)pyrazol-3-one (PubChem CID 4227069) has the molecular formula C13H13Cl3N2O2 and a molecular weight of 335.62 g/mol. Its IUPAC name is 1,5-dimethyl-2-phenyl-4-(2,2,2-trichloro-1-hydroxyethyl)pyrazol-3-one.
| Compound Name | 1,5-dimethyl-2-phenyl-4-(2,2,2-trichloro-1-hydroxyethyl)pyrazol-3-one |
|---|---|
| PubChem CID | 4227069 |
| Molecular Formula | C13H13Cl3N2O2 |
| Molecular Weight | 335.62 g/mol |
| Exact Mass | 334.00 |
| IUPAC Name | 1,5-dimethyl-2-phenyl-4-(2,2,2-trichloro-1-hydroxyethyl)pyrazol-3-one |
| SMILES | Cc1c(C(O)C(Cl)(Cl)Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C13H13Cl3N2O2/c1-8-10(11(19)13(14,15)16)12(20)18(17(8)2)9-6-4-3-5-7-9/h3-7,11,19H,1-2H3 |
| InChIKey | CBWIRKNOTYTLFV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.62 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|