C18H16N2O3 — CID 134119473
phenyl 1,5-dimethyl-3-oxo-2-phenylpyrazole-4-carboxylate (PubChem CID 134119473) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is phenyl 1,5-dimethyl-3-oxo-2-phenylpyrazole-4-carboxylate.
| Compound Name | phenyl 1,5-dimethyl-3-oxo-2-phenylpyrazole-4-carboxylate |
|---|---|
| PubChem CID | 134119473 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | phenyl 1,5-dimethyl-3-oxo-2-phenylpyrazole-4-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccccc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C18H16N2O3/c1-13-16(18(22)23-15-11-7-4-8-12-15)17(21)20(19(13)2)14-9-5-3-6-10-14/h3-12H,1-2H3 |
| InChIKey | CWVXWPGXRPOGSN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|