C17H14N2O3 — CID 170985188
1-methyl-3-oxo-2,5-diphenylpyrazole-4-carboxylic acid (PubChem CID 170985188) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 1-methyl-3-oxo-2,5-diphenylpyrazole-4-carboxylic acid.
| Compound Name | 1-methyl-3-oxo-2,5-diphenylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 170985188 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-methyl-3-oxo-2,5-diphenylpyrazole-4-carboxylic acid |
| SMILES | Cn1c(-c2ccccc2)c(C(=O)O)c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C17H14N2O3/c1-18-15(12-8-4-2-5-9-12)14(17(21)22)16(20)19(18)13-10-6-3-7-11-13/h2-11H,1H3,(H,21,22) |
| InChIKey | ISSXPDOZBCHUJC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |