C25H17FN2O3 — CID 177481591
6-fluoro-9-methyl-1-oxo-2,3-diphenylpyrido[3,4-b]indole-4-carboxylic acid (PubChem CID 177481591) has the molecular formula C25H17FN2O3 and a molecular weight of 412.42 g/mol. Its IUPAC name is 6-fluoro-9-methyl-1-oxo-2,3-diphenylpyrido[3,4-b]indole-4-carboxylic acid.
| Compound Name | 6-fluoro-9-methyl-1-oxo-2,3-diphenylpyrido[3,4-b]indole-4-carboxylic acid |
|---|---|
| PubChem CID | 177481591 |
| Molecular Formula | C25H17FN2O3 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 6-fluoro-9-methyl-1-oxo-2,3-diphenylpyrido[3,4-b]indole-4-carboxylic acid |
| SMILES | Cn1c2ccc(F)cc2c2c(C(=O)O)c(-c3ccccc3)n(-c3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C25H17FN2O3/c1-27-19-13-12-16(26)14-18(19)20-21(25(30)31)22(15-8-4-2-5-9-15)28(24(29)23(20)27)17-10-6-3-7-11-17/h2-14H,1H3,(H,30,31) |
| InChIKey | UOAPBGXEUOOQEE-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 64.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |