C23H20FN3O2 — CID 141164758
3-fluoro-9-methyl-2-phenyl-4-(pyrrolidine-1-carbonyl)pyrido[3,4-b]indol-1-one (PubChem CID 141164758) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is 3-fluoro-9-methyl-2-phenyl-4-(pyrrolidine-1-carbonyl)pyrido[3,4-b]indol-1-one.
| Compound Name | 3-fluoro-9-methyl-2-phenyl-4-(pyrrolidine-1-carbonyl)pyrido[3,4-b]indol-1-one |
|---|---|
| PubChem CID | 141164758 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 3-fluoro-9-methyl-2-phenyl-4-(pyrrolidine-1-carbonyl)pyrido[3,4-b]indol-1-one |
| SMILES | Cn1c2ccccc2c2c(C(=O)N3CCCC3)c(F)n(-c3ccccc3)c(=O)c21 |
| InChI | InChI=1S/C23H20FN3O2/c1-25-17-12-6-5-11-16(17)18-19(22(28)26-13-7-8-14-26)21(24)27(23(29)20(18)25)15-9-3-2-4-10-15/h2-6,9-12H,7-8,13-14H2,1H3 |
| InChIKey | OOLWUXZSVWDDHY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|