C16H19N3O2 — CID 13143651
2-amino-1-methyl-3-(piperidine-1-carbonyl)quinolin-4-one (PubChem CID 13143651) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 2-amino-1-methyl-3-(piperidine-1-carbonyl)quinolin-4-one.
| Compound Name | 2-amino-1-methyl-3-(piperidine-1-carbonyl)quinolin-4-one |
|---|---|
| PubChem CID | 13143651 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 2-amino-1-methyl-3-(piperidine-1-carbonyl)quinolin-4-one |
| SMILES | Cn1c(N)c(C(=O)N2CCCCC2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C16H19N3O2/c1-18-12-8-4-3-7-11(12)14(20)13(15(18)17)16(21)19-9-5-2-6-10-19/h3-4,7-8H,2,5-6,9-10,17H2,1H3 |
| InChIKey | DVSYONWFKCDVGW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |