C27H24N4O2 — CID 174903564
1,5-dimethyl-2,4-diphenylpyrazol-3-one;quinoline-4-carboxamide (PubChem CID 174903564) has the molecular formula C27H24N4O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 1,5-dimethyl-2,4-diphenylpyrazol-3-one;quinoline-4-carboxamide.
| Compound Name | 1,5-dimethyl-2,4-diphenylpyrazol-3-one;quinoline-4-carboxamide |
|---|---|
| PubChem CID | 174903564 |
| Molecular Formula | C27H24N4O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1,5-dimethyl-2,4-diphenylpyrazol-3-one;quinoline-4-carboxamide |
| SMILES | Cc1c(-c2ccccc2)c(=O)n(-c2ccccc2)n1C.NC(=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C17H16N2O.C10H8N2O/c1-13-16(14-9-5-3-6-10-14)17(20)19(18(13)2)15-11-7-4-8-12-15;11-10(13)8-5-6-12-9-4-2-1-3-7(8)9/h3-12H,1-2H3;1-6H,(H2,11,13) |
| InChIKey | SDIUEJOVDHZTPC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 82.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |