C20H19N5O — CID 13330527
4-(5-amino-1-phenylpyrazol-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 13330527) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is 4-(5-amino-1-phenylpyrazol-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-(5-amino-1-phenylpyrazol-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 13330527 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | 4-(5-amino-1-phenylpyrazol-3-yl)-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(-c2cc(N)n(-c3ccccc3)n2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H19N5O/c1-14-19(20(26)25(23(14)2)16-11-7-4-8-12-16)17-13-18(21)24(22-17)15-9-5-3-6-10-15/h3-13H,21H2,1-2H3 |
| InChIKey | CIDWIZOCLNZSCV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |