C20H17ClN6OS — CID 163183697
4-[2-amino-5-[(2-chlorophenyl)diazenyl]-1,3-thiazol-4-yl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 163183697) has the molecular formula C20H17ClN6OS and a molecular weight of 424.92 g/mol. Its IUPAC name is 4-[2-amino-5-[(2-chlorophenyl)diazenyl]-1,3-thiazol-4-yl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[2-amino-5-[(2-chlorophenyl)diazenyl]-1,3-thiazol-4-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 163183697 |
| Molecular Formula | C20H17ClN6OS |
| Molecular Weight | 424.92 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 4-[2-amino-5-[(2-chlorophenyl)diazenyl]-1,3-thiazol-4-yl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(-c2nc(N)sc2/N=N/c2ccccc2Cl)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H17ClN6OS/c1-12-16(19(28)27(26(12)2)13-8-4-3-5-9-13)17-18(29-20(22)23-17)25-24-15-11-7-6-10-14(15)21/h3-11H,1-2H3,(H2,22,23)/b25-24+ |
| InChIKey | DWJCOMJDCNKWFK-OCOZRVBESA-N |
| XLogP | 5.26 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.92 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|