C19H22N6O — CID 15548714
4-[[2-amino-4-(dimethylamino)phenyl]diazenyl]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 15548714) has the molecular formula C19H22N6O and a molecular weight of 350.43 g/mol. Its IUPAC name is 4-[[2-amino-4-(dimethylamino)phenyl]diazenyl]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[2-amino-4-(dimethylamino)phenyl]diazenyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 15548714 |
| Molecular Formula | C19H22N6O |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-[[2-amino-4-(dimethylamino)phenyl]diazenyl]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=N/c2ccc(N(C)C)cc2N)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C19H22N6O/c1-13-18(19(26)25(24(13)4)14-8-6-5-7-9-14)22-21-17-11-10-15(23(2)3)12-16(17)20/h5-12H,20H2,1-4H3/b22-21+ |
| InChIKey | FVPOHQVEODGIPU-QURGRASLSA-N |
| XLogP | 3.55 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|