C15H21N5O — CID 785550
4-(diethylaminodiazenyl)-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 785550) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-(diethylaminodiazenyl)-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-(diethylaminodiazenyl)-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 785550 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-(diethylaminodiazenyl)-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CCN(CC)/N=N/c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C15H21N5O/c1-5-19(6-2)17-16-14-12(3)18(4)20(15(14)21)13-10-8-7-9-11-13/h7-11H,5-6H2,1-4H3/b17-16+ |
| InChIKey | SXBYTWVXKHHING-WUKNDPDISA-N |
| XLogP | 2.82 |
| TPSA | 54.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|