C20H21BrN4O — CID 4045753
4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 4045753) has the molecular formula C20H21BrN4O and a molecular weight of 413.32 g/mol. Its IUPAC name is 4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4045753 |
| Molecular Formula | C20H21BrN4O |
| Molecular Weight | 413.32 g/mol |
| Exact Mass | 412.09 |
| IUPAC Name | 4-[[3-bromo-4-(dimethylamino)phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C/c2ccc(N(C)C)c(Br)c2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C20H21BrN4O/c1-14-19(20(26)25(24(14)4)16-8-6-5-7-9-16)22-13-15-10-11-18(23(2)3)17(21)12-15/h5-13H,1-4H3/b22-13+ |
| InChIKey | PJOAKXGZZVXNDF-LPYMAVHISA-N |
| XLogP | 4.06 |
| TPSA | 42.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|