C28H29N3O3 — CID 3871120
4-[[3-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 3871120) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 4-[[3-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[3-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 3871120 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 4-[[3-[2-(3,4-dimethylphenoxy)ethoxy]phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1ccc(OCCOc2cccc(/C=N/c3c(C)n(C)n(-c4ccccc4)c3=O)c2)cc1C |
| InChI | InChI=1S/C28H29N3O3/c1-20-13-14-26(17-21(20)2)34-16-15-33-25-12-8-9-23(18-25)19-29-27-22(3)30(4)31(28(27)32)24-10-6-5-7-11-24/h5-14,17-19H,15-16H2,1-4H3/b29-19+ |
| InChIKey | OTQLFHZMGIVTIU-VUTHCHCSSA-N |
| XLogP | 5.31 |
| TPSA | 57.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|