C26H24N4O4 — CID 154585357
[4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-2-ethoxyphenyl] pyridine-4-carboxylate (PubChem CID 154585357) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is [4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-2-ethoxyphenyl] pyridine-4-carboxylate.
| Compound Name | [4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-2-ethoxyphenyl] pyridine-4-carboxylate |
|---|---|
| PubChem CID | 154585357 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [4-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]-2-ethoxyphenyl] pyridine-4-carboxylate |
| SMILES | CCOc1cc(/C=N/c2c(C)n(C)n(-c3ccccc3)c2=O)ccc1OC(=O)c1ccncc1 |
| InChI | InChI=1S/C26H24N4O4/c1-4-33-23-16-19(10-11-22(23)34-26(32)20-12-14-27-15-13-20)17-28-24-18(2)29(3)30(25(24)31)21-8-6-5-7-9-21/h5-17H,4H2,1-3H3/b28-17+ |
| InChIKey | YAOBJNRHZVBXRZ-OGLMXYFKSA-N |
| XLogP | 4.25 |
| TPSA | 87.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|