C20H21N3O5 — CID 139070005
2-[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]phenoxy]acetic acid;hydrate (PubChem CID 139070005) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]phenoxy]acetic acid;hydrate.
| Compound Name | 2-[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]phenoxy]acetic acid;hydrate |
|---|---|
| PubChem CID | 139070005 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 2-[2-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]phenoxy]acetic acid;hydrate |
| SMILES | Cc1c(/N=C/c2ccccc2OCC(=O)O)c(=O)n(-c2ccccc2)n1C.O |
| InChI | InChI=1S/C20H19N3O4.H2O/c1-14-19(20(26)23(22(14)2)16-9-4-3-5-10-16)21-12-15-8-6-7-11-17(15)27-13-18(24)25;/h3-12H,13H2,1-2H3,(H,24,25);1H2/b21-12+; |
| InChIKey | JAMNWELOBQPZMI-BFVDCFMLSA-N |
| XLogP | 1.87 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|