C24H21N3O — CID 1099344
4-(1,2-dihydroacenaphthylen-5-ylmethylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 1099344) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is 4-(1,2-dihydroacenaphthylen-5-ylmethylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-(1,2-dihydroacenaphthylen-5-ylmethylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 1099344 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 4-(1,2-dihydroacenaphthylen-5-ylmethylideneamino)-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C/c2ccc3c4c(cccc24)CC3)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C24H21N3O/c1-16-23(24(28)27(26(16)2)20-8-4-3-5-9-20)25-15-19-14-13-18-12-11-17-7-6-10-21(19)22(17)18/h3-10,13-15H,11-12H2,1-2H3/b25-15+ |
| InChIKey | WQIYCLJCJXWOEX-MFKUBSTISA-N |
| XLogP | 4.49 |
| TPSA | 39.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|