C24H20ClN5O2 — CID 136798482
4-[[4-[(4-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 136798482) has the molecular formula C24H20ClN5O2 and a molecular weight of 445.91 g/mol. Its IUPAC name is 4-[[4-[(4-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[4-[(4-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 136798482 |
| Molecular Formula | C24H20ClN5O2 |
| Molecular Weight | 445.91 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 4-[[4-[(4-chlorophenyl)diazenyl]-2-hydroxyphenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C/c2ccc(/N=N/c3ccc(Cl)cc3)cc2O)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C24H20ClN5O2/c1-16-23(24(32)30(29(16)2)21-6-4-3-5-7-21)26-15-17-8-11-20(14-22(17)31)28-27-19-12-9-18(25)10-13-19/h3-15,31H,1-2H3/b26-15+,28-27+ |
| InChIKey | PZNUINZZJJVJII-AFLDOIPMSA-N |
| XLogP | 6.01 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.91 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|