C25H22ClN3O2 — CID 92664419
4-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 92664419) has the molecular formula C25H22ClN3O2 and a molecular weight of 431.92 g/mol. Its IUPAC name is 4-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 92664419 |
| Molecular Formula | C25H22ClN3O2 |
| Molecular Weight | 431.92 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | 4-[[4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C/c2ccc(OCc3ccc(Cl)cc3)cc2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C25H22ClN3O2/c1-18-24(25(30)29(28(18)2)22-6-4-3-5-7-22)27-16-19-10-14-23(15-11-19)31-17-20-8-12-21(26)13-9-20/h3-16H,17H2,1-2H3/b27-16+ |
| InChIKey | LYUFEWYLKYBYIW-JVWAILMASA-N |
| XLogP | 5.47 |
| TPSA | 48.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.92 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|