C27H24Cl2IN3O3 — CID 23967905
4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 23967905) has the molecular formula C27H24Cl2IN3O3 and a molecular weight of 636.32 g/mol. Its IUPAC name is 4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23967905 |
| Molecular Formula | C27H24Cl2IN3O3 |
| Molecular Weight | 636.32 g/mol |
| Exact Mass | 635.02 |
| IUPAC Name | 4-[[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CCOc1cc(/C=N/c2c(C)n(C)n(-c3ccccc3)c2=O)cc(I)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H24Cl2IN3O3/c1-4-35-24-13-18(12-23(30)26(24)36-16-19-10-11-20(28)14-22(19)29)15-31-25-17(2)32(3)33(27(25)34)21-8-6-5-7-9-21/h5-15H,4,16H2,1-3H3/b31-15+ |
| InChIKey | KYNFJNQXWSALRT-IBBHUPRXSA-N |
| XLogP | 7.12 |
| TPSA | 57.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.32 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|