C22H24ClN3O2 — CID 545014
4-[(2-butoxy-5-chlorophenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one (PubChem CID 545014) has the molecular formula C22H24ClN3O2 and a molecular weight of 397.91 g/mol. Its IUPAC name is 4-[(2-butoxy-5-chlorophenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one.
| Compound Name | 4-[(2-butoxy-5-chlorophenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 545014 |
| Molecular Formula | C22H24ClN3O2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-[(2-butoxy-5-chlorophenyl)methylideneamino]-1,5-dimethyl-2-phenylpyrazol-3-one |
| SMILES | CCCCOc1ccc(Cl)cc1/C=N/c1c(C)n(C)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C22H24ClN3O2/c1-4-5-13-28-20-12-11-18(23)14-17(20)15-24-21-16(2)25(3)26(22(21)27)19-9-7-6-8-10-19/h6-12,14-15H,4-5,13H2,1-3H3/b24-15+ |
| InChIKey | VYKHJAJQVWKIMM-BUVRLJJBSA-N |
| XLogP | 5.07 |
| TPSA | 48.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|