C23H17ClN3O4- — CID 2254709
2-chloro-5-[5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]furan-2-yl]benzoate (PubChem CID 2254709) has the molecular formula C23H17ClN3O4- and a molecular weight of 434.86 g/mol. Its IUPAC name is 2-chloro-5-[5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]furan-2-yl]benzoate.
| Compound Name | 2-chloro-5-[5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 2254709 |
| Molecular Formula | C23H17ClN3O4- |
| Molecular Weight | 434.86 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | 2-chloro-5-[5-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)iminomethyl]furan-2-yl]benzoate |
| SMILES | Cc1c(/N=C/c2ccc(-c3ccc(Cl)c(C(=O)[O-])c3)o2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C23H18ClN3O4/c1-14-21(22(28)27(26(14)2)16-6-4-3-5-7-16)25-13-17-9-11-20(31-17)15-8-10-19(24)18(12-15)23(29)30/h3-13H,1-2H3,(H,29,30)/p-1/b25-13+ |
| InChIKey | QKEDVWBZXBQINQ-DHRITJCHSA-M |
| XLogP | 3.51 |
| TPSA | 92.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.86 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|