C26H25N5O5 — CID 23827778
1,5-dimethyl-4-[[5-(4-morpholin-4-yl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylpyrazol-3-one (PubChem CID 23827778) has the molecular formula C26H25N5O5 and a molecular weight of 487.52 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[5-(4-morpholin-4-yl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[[5-(4-morpholin-4-yl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 23827778 |
| Molecular Formula | C26H25N5O5 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 1,5-dimethyl-4-[[5-(4-morpholin-4-yl-3-nitrophenyl)furan-2-yl]methylideneamino]-2-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C/c2ccc(-c3ccc(N4CCOCC4)c([N+](=O)[O-])c3)o2)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C26H25N5O5/c1-18-25(26(32)30(28(18)2)20-6-4-3-5-7-20)27-17-21-9-11-24(36-21)19-8-10-22(23(16-19)31(33)34)29-12-14-35-15-13-29/h3-11,16-17H,12-15H2,1-2H3/b27-17+ |
| InChIKey | QGKYMOQSAHVZQT-WPWMEQJKSA-N |
| XLogP | 4.24 |
| TPSA | 108.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|